S-Adenosyl-L-methionine disulfate tosylate
CAS 97540-22-2
Assay 99%min
Packing 25kg/drum
Ademetionine disulfate tosylate
| Name | Ademetionine disulfate tosylate |
| Synonyms | S-Adenosyl-L-methionine disulfate tosylate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N6O5S.2(H2SO4).C7H8SO3 |
| Molecular Weight | 766.79 |
| CAS Registry Number | 97540-22-2 |
| EC Number | 810-270-9 |
Uses:
1. Liver protection and treatment of bile stasis.
2. Emotional regulation and antidepressant assistance application.
3. Osteoarthritis and cartilage repair support.
4. Antioxidant and metabolic regulatory effects.
5. Neuroprotection and ischemic injury intervention.
Contact: Miss.Pan
Phone: 0086-15867449652
E-mail: info@surestchem.com
Whatsapp: +8617757067892
Add: 2124,No.1018,Min’an Road, Yinzhou District,Ningbo,China,315100.
We chat